C19H15N3O2 — CID 58574163
8-hydroxy-3-(2-pyridin-2-ylethynyl)-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one (PubChem CID 58574163) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 8-hydroxy-3-(2-pyridin-2-ylethynyl)-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one.
| Compound Name | 8-hydroxy-3-(2-pyridin-2-ylethynyl)-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 58574163 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 8-hydroxy-3-(2-pyridin-2-ylethynyl)-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one |
| SMILES | O=c1c2ccc(C#Cc3ccccn3)cc2nc2n1CC(O)CC2 |
| InChI | InChI=1S/C19H15N3O2/c23-15-7-9-18-21-17-11-13(4-6-14-3-1-2-10-20-14)5-8-16(17)19(24)22(18)12-15/h1-3,5,8,10-11,15,23H,7,9,12H2 |
| InChIKey | DVLAEXAXBJZJFS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|