C21H17N5O — CID 53250577
2-[11-oxo-8-(2-pyridin-2-ylethynyl)-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-3-yl]acetonitrile (PubChem CID 53250577) has the molecular formula C21H17N5O and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-[11-oxo-8-(2-pyridin-2-ylethynyl)-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-3-yl]acetonitrile.
| Compound Name | 2-[11-oxo-8-(2-pyridin-2-ylethynyl)-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 53250577 |
| Molecular Formula | C21H17N5O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[11-oxo-8-(2-pyridin-2-ylethynyl)-1,2,4,5-tetrahydro-[1,4]diazepino[7,1-b]quinazolin-3-yl]acetonitrile |
| SMILES | N#CCN1CCc2nc3cc(C#Cc4ccccn4)ccc3c(=O)n2CC1 |
| InChI | InChI=1S/C21H17N5O/c22-9-12-25-11-8-20-24-19-15-16(4-6-17-3-1-2-10-23-17)5-7-18(19)21(27)26(20)14-13-25/h1-3,5,7,10,15H,8,11-14H2 |
| InChIKey | UAYOHLCOKXWKPC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|