C19H16N4O — CID 58574559
6-(2-pyridin-2-ylethynyl)-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-2-one (PubChem CID 58574559) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 6-(2-pyridin-2-ylethynyl)-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-2-one.
| Compound Name | 6-(2-pyridin-2-ylethynyl)-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-2-one |
|---|---|
| PubChem CID | 58574559 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 6-(2-pyridin-2-ylethynyl)-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-2-one |
| SMILES | O=c1c2ncc(C#Cc3ccccn3)cc2nc2n1CCCCC2 |
| InChI | InChI=1S/C19H16N4O/c24-19-18-16(22-17-7-2-1-5-11-23(17)19)12-14(13-21-18)8-9-15-6-3-4-10-20-15/h3-4,6,10,12-13H,1-2,5,7,11H2 |
| InChIKey | VUFJXKBLJVTADI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|