C19H15N3O — CID 134237914
7-methyl-3-(2-pyridin-2-ylethynyl)-7,8-dihydro-6H-pyrrolo[2,1-g][1,7]naphthyridin-10-one (PubChem CID 134237914) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 7-methyl-3-(2-pyridin-2-ylethynyl)-7,8-dihydro-6H-pyrrolo[2,1-g][1,7]naphthyridin-10-one.
| Compound Name | 7-methyl-3-(2-pyridin-2-ylethynyl)-7,8-dihydro-6H-pyrrolo[2,1-g][1,7]naphthyridin-10-one |
|---|---|
| PubChem CID | 134237914 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 7-methyl-3-(2-pyridin-2-ylethynyl)-7,8-dihydro-6H-pyrrolo[2,1-g][1,7]naphthyridin-10-one |
| SMILES | CC1Cc2cc3cc(C#Cc4ccccn4)cnc3c(=O)n2C1 |
| InChI | InChI=1S/C19H15N3O/c1-13-8-17-10-15-9-14(5-6-16-4-2-3-7-20-16)11-21-18(15)19(23)22(17)12-13/h2-4,7,9-11,13H,8,12H2,1H3 |
| InChIKey | LFBBCZYHKACDAT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|