C20H15F3N4O — CID 134243580
13-methyl-6-(2-pyridin-2-ylethynyl)-13-(trifluoromethyl)-1,4,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9-tetraen-2-one (PubChem CID 134243580) has the molecular formula C20H15F3N4O and a molecular weight of 384.36 g/mol. Its IUPAC name is 13-methyl-6-(2-pyridin-2-ylethynyl)-13-(trifluoromethyl)-1,4,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9-tetraen-2-one.
| Compound Name | 13-methyl-6-(2-pyridin-2-ylethynyl)-13-(trifluoromethyl)-1,4,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9-tetraen-2-one |
|---|---|
| PubChem CID | 134243580 |
| Molecular Formula | C20H15F3N4O |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 13-methyl-6-(2-pyridin-2-ylethynyl)-13-(trifluoromethyl)-1,4,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9-tetraen-2-one |
| SMILES | CC1(C(F)(F)F)CCc2nc3cc(C#Cc4ccccn4)cnc3c(=O)n2C1 |
| InChI | InChI=1S/C20H15F3N4O/c1-19(20(21,22)23)8-7-16-26-15-10-13(5-6-14-4-2-3-9-24-14)11-25-17(15)18(28)27(16)12-19/h2-4,9-11H,7-8,12H2,1H3 |
| InChIKey | FMACABKAPFELMK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|