C23H21N3O — CID 90249508
8-cyclopropyl-8-methyl-3-(2-pyridin-2-ylethynyl)-7,9-dihydro-6H-pyrido[2,1-b]quinazolin-11-one (PubChem CID 90249508) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 8-cyclopropyl-8-methyl-3-(2-pyridin-2-ylethynyl)-7,9-dihydro-6H-pyrido[2,1-b]quinazolin-11-one.
| Compound Name | 8-cyclopropyl-8-methyl-3-(2-pyridin-2-ylethynyl)-7,9-dihydro-6H-pyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 90249508 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 8-cyclopropyl-8-methyl-3-(2-pyridin-2-ylethynyl)-7,9-dihydro-6H-pyrido[2,1-b]quinazolin-11-one |
| SMILES | CC1(C2CC2)CCc2nc3cc(C#Cc4ccccn4)ccc3c(=O)n2C1 |
| InChI | InChI=1S/C23H21N3O/c1-23(17-7-8-17)12-11-21-25-20-14-16(5-9-18-4-2-3-13-24-18)6-10-19(20)22(27)26(21)15-23/h2-4,6,10,13-14,17H,7-8,11-12,15H2,1H3 |
| InChIKey | FHNACKQXOVTIEO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|