C21H18FN3O — CID 58574432
1-fluoro-8,8-dimethyl-3-(2-pyridin-2-ylethynyl)-7,9-dihydro-6H-pyrido[2,1-b]quinazolin-11-one (PubChem CID 58574432) has the molecular formula C21H18FN3O and a molecular weight of 347.39 g/mol. Its IUPAC name is 1-fluoro-8,8-dimethyl-3-(2-pyridin-2-ylethynyl)-7,9-dihydro-6H-pyrido[2,1-b]quinazolin-11-one.
| Compound Name | 1-fluoro-8,8-dimethyl-3-(2-pyridin-2-ylethynyl)-7,9-dihydro-6H-pyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 58574432 |
| Molecular Formula | C21H18FN3O |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-fluoro-8,8-dimethyl-3-(2-pyridin-2-ylethynyl)-7,9-dihydro-6H-pyrido[2,1-b]quinazolin-11-one |
| SMILES | CC1(C)CCc2nc3cc(C#Cc4ccccn4)cc(F)c3c(=O)n2C1 |
| InChI | InChI=1S/C21H18FN3O/c1-21(2)9-8-18-24-17-12-14(6-7-15-5-3-4-10-23-15)11-16(22)19(17)20(26)25(18)13-21/h3-5,10-12H,8-9,13H2,1-2H3 |
| InChIKey | NJRDKVKAWQDPSX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|