C21H17F2N3O — CID 90249528
3-[2-(2,5-difluoro-4-pyridinyl)ethynyl]-8,8-dimethyl-7,9-dihydro-6H-pyrido[2,1-b]quinazolin-11-one (PubChem CID 90249528) has the molecular formula C21H17F2N3O and a molecular weight of 365.38 g/mol. Its IUPAC name is 3-[2-(2,5-difluoro-4-pyridinyl)ethynyl]-8,8-dimethyl-7,9-dihydro-6H-pyrido[2,1-b]quinazolin-11-one.
| Compound Name | 3-[2-(2,5-difluoro-4-pyridinyl)ethynyl]-8,8-dimethyl-7,9-dihydro-6H-pyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 90249528 |
| Molecular Formula | C21H17F2N3O |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 3-[2-(2,5-difluoro-4-pyridinyl)ethynyl]-8,8-dimethyl-7,9-dihydro-6H-pyrido[2,1-b]quinazolin-11-one |
| SMILES | CC1(C)CCc2nc3cc(C#Cc4cc(F)ncc4F)ccc3c(=O)n2C1 |
| InChI | InChI=1S/C21H17F2N3O/c1-21(2)8-7-19-25-17-9-13(4-6-15(17)20(27)26(19)12-21)3-5-14-10-18(23)24-11-16(14)22/h4,6,9-11H,7-8,12H2,1-2H3 |
| InChIKey | HUIXFKUOMRTSIF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|