C24H24FN3O — CID 123302834
6-[2-(3-fluorophenyl)ethynyl]-13-methyl-1,9,13-triazatricyclo[8.8.0.03,8]octadeca-3(8),4,6,9-tetraen-2-one (PubChem CID 123302834) has the molecular formula C24H24FN3O and a molecular weight of 389.47 g/mol. Its IUPAC name is 6-[2-(3-fluorophenyl)ethynyl]-13-methyl-1,9,13-triazatricyclo[8.8.0.03,8]octadeca-3(8),4,6,9-tetraen-2-one.
| Compound Name | 6-[2-(3-fluorophenyl)ethynyl]-13-methyl-1,9,13-triazatricyclo[8.8.0.03,8]octadeca-3(8),4,6,9-tetraen-2-one |
|---|---|
| PubChem CID | 123302834 |
| Molecular Formula | C24H24FN3O |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 6-[2-(3-fluorophenyl)ethynyl]-13-methyl-1,9,13-triazatricyclo[8.8.0.03,8]octadeca-3(8),4,6,9-tetraen-2-one |
| SMILES | CN1CCCCCn2c(nc3cc(C#Cc4cccc(F)c4)ccc3c2=O)CC1 |
| InChI | InChI=1S/C24H24FN3O/c1-27-13-3-2-4-14-28-23(12-15-27)26-22-17-19(10-11-21(22)24(28)29)9-8-18-6-5-7-20(25)16-18/h5-7,10-11,16-17H,2-4,12-15H2,1H3 |
| InChIKey | IZIQDBDZGRFSAI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|