C20H13FN2O — CID 58574726
3-[2-(3-fluorophenyl)ethynyl]-8,9-dihydropyrido[2,1-b]quinazolin-11-one (PubChem CID 58574726) has the molecular formula C20H13FN2O and a molecular weight of 316.34 g/mol. Its IUPAC name is 3-[2-(3-fluorophenyl)ethynyl]-8,9-dihydropyrido[2,1-b]quinazolin-11-one.
| Compound Name | 3-[2-(3-fluorophenyl)ethynyl]-8,9-dihydropyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 58574726 |
| Molecular Formula | C20H13FN2O |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3-[2-(3-fluorophenyl)ethynyl]-8,9-dihydropyrido[2,1-b]quinazolin-11-one |
| SMILES | O=c1c2ccc(C#Cc3cccc(F)c3)cc2nc2n1CCC=C2 |
| InChI | InChI=1S/C20H13FN2O/c21-16-5-3-4-14(12-16)7-8-15-9-10-17-18(13-15)22-19-6-1-2-11-23(19)20(17)24/h1,3-6,9-10,12-13H,2,11H2 |
| InChIKey | XXOXRPLWDVYOBV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|