C18H12FN3O2 — CID 58574497
9-[2-(5-fluoro-2-pyridinyl)ethynyl]-3,4-dihydro-1H-[1,4]oxazino[3,4-b]quinazolin-6-one (PubChem CID 58574497) has the molecular formula C18H12FN3O2 and a molecular weight of 321.31 g/mol. Its IUPAC name is 9-[2-(5-fluoro-2-pyridinyl)ethynyl]-3,4-dihydro-1H-[1,4]oxazino[3,4-b]quinazolin-6-one.
| Compound Name | 9-[2-(5-fluoro-2-pyridinyl)ethynyl]-3,4-dihydro-1H-[1,4]oxazino[3,4-b]quinazolin-6-one |
|---|---|
| PubChem CID | 58574497 |
| Molecular Formula | C18H12FN3O2 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 9-[2-(5-fluoro-2-pyridinyl)ethynyl]-3,4-dihydro-1H-[1,4]oxazino[3,4-b]quinazolin-6-one |
| SMILES | O=c1c2ccc(C#Cc3ccc(F)cn3)cc2nc2n1CCOC2 |
| InChI | InChI=1S/C18H12FN3O2/c19-13-3-5-14(20-10-13)4-1-12-2-6-15-16(9-12)21-17-11-24-8-7-22(17)18(15)23/h2-3,5-6,9-10H,7-8,11H2 |
| InChIKey | HUDZVVWYBVVUEK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|