C19H13FN2O2 — CID 53250280
9-[2-(3-fluorophenyl)ethynyl]-3,4-dihydro-1H-[1,4]oxazino[3,4-b]quinazolin-6-one (PubChem CID 53250280) has the molecular formula C19H13FN2O2 and a molecular weight of 320.32 g/mol. Its IUPAC name is 9-[2-(3-fluorophenyl)ethynyl]-3,4-dihydro-1H-[1,4]oxazino[3,4-b]quinazolin-6-one.
| Compound Name | 9-[2-(3-fluorophenyl)ethynyl]-3,4-dihydro-1H-[1,4]oxazino[3,4-b]quinazolin-6-one |
|---|---|
| PubChem CID | 53250280 |
| Molecular Formula | C19H13FN2O2 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 9-[2-(3-fluorophenyl)ethynyl]-3,4-dihydro-1H-[1,4]oxazino[3,4-b]quinazolin-6-one |
| SMILES | O=c1c2ccc(C#Cc3cccc(F)c3)cc2nc2n1CCOC2 |
| InChI | InChI=1S/C19H13FN2O2/c20-15-3-1-2-13(10-15)4-5-14-6-7-16-17(11-14)21-18-12-24-9-8-22(18)19(16)23/h1-3,6-7,10-11H,8-9,12H2 |
| InChIKey | NEWWJUVRGMPOJX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|