C19H24N2OSi — CID 58574167
8-methyl-3-(2-trimethylsilylethynyl)-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-12-one (PubChem CID 58574167) has the molecular formula C19H24N2OSi and a molecular weight of 324.50 g/mol. Its IUPAC name is 8-methyl-3-(2-trimethylsilylethynyl)-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-12-one.
| Compound Name | 8-methyl-3-(2-trimethylsilylethynyl)-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-12-one |
|---|---|
| PubChem CID | 58574167 |
| Molecular Formula | C19H24N2OSi |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 8-methyl-3-(2-trimethylsilylethynyl)-7,8,9,10-tetrahydro-6H-azepino[2,1-b]quinazolin-12-one |
| SMILES | CC1CCc2nc3cc(C#C[Si](C)(C)C)ccc3c(=O)n2CC1 |
| InChI | InChI=1S/C19H24N2OSi/c1-14-5-8-18-20-17-13-15(10-12-23(2,3)4)6-7-16(17)19(22)21(18)11-9-14/h6-7,13-14H,5,8-9,11H2,1-4H3 |
| InChIKey | OVDFTRVIIQMBLB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|