C13H14BrN3O — CID 58574333
6-bromo-13-methyl-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-2-one (PubChem CID 58574333) has the molecular formula C13H14BrN3O and a molecular weight of 308.18 g/mol. Its IUPAC name is 6-bromo-13-methyl-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-2-one.
| Compound Name | 6-bromo-13-methyl-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-2-one |
|---|---|
| PubChem CID | 58574333 |
| Molecular Formula | C13H14BrN3O |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 6-bromo-13-methyl-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-2-one |
| SMILES | CC1CCc2nc3cc(Br)cnc3c(=O)n2CC1 |
| InChI | InChI=1S/C13H14BrN3O/c1-8-2-3-11-16-10-6-9(14)7-15-12(10)13(18)17(11)5-4-8/h6-8H,2-5H2,1H3 |
| InChIKey | OZVYRCDYVSMZGW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |