C22H20N2O2 — CID 90273542
8-(hydroxymethyl)-3-[2-(3-methylphenyl)ethynyl]-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one (PubChem CID 90273542) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 8-(hydroxymethyl)-3-[2-(3-methylphenyl)ethynyl]-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one.
| Compound Name | 8-(hydroxymethyl)-3-[2-(3-methylphenyl)ethynyl]-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 90273542 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 8-(hydroxymethyl)-3-[2-(3-methylphenyl)ethynyl]-6,7,8,9-tetrahydropyrido[2,1-b]quinazolin-11-one |
| SMILES | Cc1cccc(C#Cc2ccc3c(=O)n4c(nc3c2)CCC(CO)C4)c1 |
| InChI | InChI=1S/C22H20N2O2/c1-15-3-2-4-16(11-15)5-6-17-7-9-19-20(12-17)23-21-10-8-18(14-25)13-24(21)22(19)26/h2-4,7,9,11-12,18,25H,8,10,13-14H2,1H3 |
| InChIKey | OLBLOUSPQSPBJC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|