C23H18F2N2O3 — CID 58574494
3'-[2-(2,4-difluorophenyl)ethynyl]spiro[1,3-dioxolane-2,8'-6,7,9,10-tetrahydroazepino[2,1-b]quinazoline]-12'-one (PubChem CID 58574494) has the molecular formula C23H18F2N2O3 and a molecular weight of 408.40 g/mol. Its IUPAC name is 3'-[2-(2,4-difluorophenyl)ethynyl]spiro[1,3-dioxolane-2,8'-6,7,9,10-tetrahydroazepino[2,1-b]quinazoline]-12'-one.
| Compound Name | 3'-[2-(2,4-difluorophenyl)ethynyl]spiro[1,3-dioxolane-2,8'-6,7,9,10-tetrahydroazepino[2,1-b]quinazoline]-12'-one |
|---|---|
| PubChem CID | 58574494 |
| Molecular Formula | C23H18F2N2O3 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3'-[2-(2,4-difluorophenyl)ethynyl]spiro[1,3-dioxolane-2,8'-6,7,9,10-tetrahydroazepino[2,1-b]quinazoline]-12'-one |
| SMILES | O=c1c2ccc(C#Cc3ccc(F)cc3F)cc2nc2n1CCC1(CC2)OCCO1 |
| InChI | InChI=1S/C23H18F2N2O3/c24-17-5-4-16(19(25)14-17)3-1-15-2-6-18-20(13-15)26-21-7-8-23(29-11-12-30-23)9-10-27(21)22(18)28/h2,4-6,13-14H,7-12H2 |
| InChIKey | CXJXRAOTFVRPCX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|