C20H18N4O — CID 123892205
(13R)-13-methyl-6-(2-pyridin-2-ylethynyl)-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-11-one (PubChem CID 123892205) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is (13R)-13-methyl-6-(2-pyridin-2-ylethynyl)-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-11-one.
| Compound Name | (13R)-13-methyl-6-(2-pyridin-2-ylethynyl)-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-11-one |
|---|---|
| PubChem CID | 123892205 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (13R)-13-methyl-6-(2-pyridin-2-ylethynyl)-1,4,9-triazatricyclo[8.5.0.03,8]pentadeca-3(8),4,6,9-tetraen-11-one |
| SMILES | C[C@@H]1CCN2Cc3ncc(C#Cc4ccccn4)cc3N=C2C(=O)C1 |
| InChI | InChI=1S/C20H18N4O/c1-14-7-9-24-13-18-17(23-20(24)19(25)10-14)11-15(12-22-18)5-6-16-4-2-3-8-21-16/h2-4,8,11-12,14H,7,9-10,13H2,1H3/t14-/m1/s1 |
| InChIKey | VCVXWCXRIMONLB-CQSZACIVSA-N |
| XLogP | 2.72 |
| TPSA | 58.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|