C28H36F3N5O4 — CID 58576857
N-[[1-(4-ethoxyphenyl)piperidin-4-yl]methyl]-N-methyl-4-[4-nitro-3-(trifluoromethyl)anilino]piperidine-1-carboxamide (PubChem CID 58576857) has the molecular formula C28H36F3N5O4 and a molecular weight of 563.62 g/mol. Its IUPAC name is N-[[1-(4-ethoxyphenyl)piperidin-4-yl]methyl]-N-methyl-4-[4-nitro-3-(trifluoromethyl)anilino]piperidine-1-carboxamide.
| Compound Name | N-[[1-(4-ethoxyphenyl)piperidin-4-yl]methyl]-N-methyl-4-[4-nitro-3-(trifluoromethyl)anilino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 58576857 |
| Molecular Formula | C28H36F3N5O4 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | N-[[1-(4-ethoxyphenyl)piperidin-4-yl]methyl]-N-methyl-4-[4-nitro-3-(trifluoromethyl)anilino]piperidine-1-carboxamide |
| SMILES | CCOc1ccc(N2CCC(CN(C)C(=O)N3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H36F3N5O4/c1-3-40-24-7-5-23(6-8-24)34-14-10-20(11-15-34)19-33(2)27(37)35-16-12-21(13-17-35)32-22-4-9-26(36(38)39)25(18-22)28(29,30)31/h4-9,18,20-21,32H,3,10-17,19H2,1-2H3 |
| InChIKey | ZVCSYAHZMGTNIG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|