C33H34F6N4O5 — CID 58576970
1-[4-[4-nitro-3-(trifluoromethyl)phenoxy]piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propan-1-one (PubChem CID 58576970) has the molecular formula C33H34F6N4O5 and a molecular weight of 680.65 g/mol. Its IUPAC name is 1-[4-[4-nitro-3-(trifluoromethyl)phenoxy]piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[4-nitro-3-(trifluoromethyl)phenoxy]piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58576970 |
| Molecular Formula | C33H34F6N4O5 |
| Molecular Weight | 680.65 g/mol |
| Exact Mass | 680.24 |
| IUPAC Name | 1-[4-[4-nitro-3-(trifluoromethyl)phenoxy]piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCN1CCN(c2ccc(OCc3ccc(C(F)(F)F)cc3)cc2)CC1)N1CCC(Oc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C33H34F6N4O5/c34-32(35,36)24-3-1-23(2-4-24)22-47-26-7-5-25(6-8-26)41-19-17-40(18-20-41)14-13-31(44)42-15-11-27(12-16-42)48-28-9-10-30(43(45)46)29(21-28)33(37,38)39/h1-10,21,27H,11-20,22H2 |
| InChIKey | URAMEUUTNLHMAP-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.65 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|