C26H31F2N3O5 — CID 58577209
3-[4-(3,4-difluorophenyl)piperidin-1-yl]-1-[4-(3-methoxy-4-nitrophenoxy)piperidin-1-yl]propan-1-one (PubChem CID 58577209) has the molecular formula C26H31F2N3O5 and a molecular weight of 503.55 g/mol. Its IUPAC name is 3-[4-(3,4-difluorophenyl)piperidin-1-yl]-1-[4-(3-methoxy-4-nitrophenoxy)piperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(3,4-difluorophenyl)piperidin-1-yl]-1-[4-(3-methoxy-4-nitrophenoxy)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58577209 |
| Molecular Formula | C26H31F2N3O5 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 3-[4-(3,4-difluorophenyl)piperidin-1-yl]-1-[4-(3-methoxy-4-nitrophenoxy)piperidin-1-yl]propan-1-one |
| SMILES | COc1cc(OC2CCN(C(=O)CCN3CCC(c4ccc(F)c(F)c4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H31F2N3O5/c1-35-25-17-21(3-5-24(25)31(33)34)36-20-8-14-30(15-9-20)26(32)10-13-29-11-6-18(7-12-29)19-2-4-22(27)23(28)16-19/h2-5,16-18,20H,6-15H2,1H3 |
| InChIKey | WBVYTQAGOXWELA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|