C25H22F3N5O — CID 58577770
1-[2-methyl-4-[3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]-3-(2-phenylpyrazol-3-yl)pyridazin-4-one (PubChem CID 58577770) has the molecular formula C25H22F3N5O and a molecular weight of 465.48 g/mol. Its IUPAC name is 1-[2-methyl-4-[3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]-3-(2-phenylpyrazol-3-yl)pyridazin-4-one.
| Compound Name | 1-[2-methyl-4-[3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]-3-(2-phenylpyrazol-3-yl)pyridazin-4-one |
|---|---|
| PubChem CID | 58577770 |
| Molecular Formula | C25H22F3N5O |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 1-[2-methyl-4-[3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]-3-(2-phenylpyrazol-3-yl)pyridazin-4-one |
| SMILES | Cc1cc(N2CCC(C(F)(F)F)C2)ccc1-n1ccc(=O)c(-c2ccnn2-c2ccccc2)n1 |
| InChI | InChI=1S/C25H22F3N5O/c1-17-15-20(31-13-10-18(16-31)25(26,27)28)7-8-21(17)32-14-11-23(34)24(30-32)22-9-12-29-33(22)19-5-3-2-4-6-19/h2-9,11-12,14-15,18H,10,13,16H2,1H3 |
| InChIKey | JTPVZDDZGLHIQP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|