C29H46O — CID 58581864
(2R,3E)-3-[(1R,3aS,7aR)-7a-methyl-1-[(E,2R,5S)-5,6,6-trimethylhept-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-2-[(1R,5R)-1-bicyclo[3.1.0]hex-2-enyl]propan-1-ol (PubChem CID 58581864) has the molecular formula C29H46O and a molecular weight of 410.69 g/mol. Its IUPAC name is (2R,3E)-3-[(1R,3aS,7aR)-7a-methyl-1-[(E,2R,5S)-5,6,6-trimethylhept-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-2-[(1R,5R)-1-bicyclo[3.1.0]hex-2-enyl]propan-1-ol.
| Compound Name | (2R,3E)-3-[(1R,3aS,7aR)-7a-methyl-1-[(E,2R,5S)-5,6,6-trimethylhept-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-2-[(1R,5R)-1-bicyclo[3.1.0]hex-2-enyl]propan-1-ol |
|---|---|
| PubChem CID | 58581864 |
| Molecular Formula | C29H46O |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.35 |
| IUPAC Name | (2R,3E)-3-[(1R,3aS,7aR)-7a-methyl-1-[(E,2R,5S)-5,6,6-trimethylhept-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-2-[(1R,5R)-1-bicyclo[3.1.0]hex-2-enyl]propan-1-ol |
| SMILES | C[C@H](/C=C/[C@H](C)C(C)(C)C)[C@H]1CC[C@H]2/C(=C/[C@@H](CO)[C@@]34C=CC[C@@H]3C4)CCC[C@]12C |
| InChI | InChI=1S/C29H46O/c1-20(11-12-21(2)27(3,4)5)25-13-14-26-22(9-7-15-28(25,26)6)17-24(19-30)29-16-8-10-23(29)18-29/h8,11-12,16-17,20-21,23-26,30H,7,9-10,13-15,18-19H2,1-6H3/b12-11+,22-17+/t20-,21+,23-,24+,25-,26+,28-,29-/m1/s1 |
| InChIKey | SFJDUKLEPDPAAW-NEUOTXTBSA-N |
| XLogP | 7.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|