C10H20O2Si — CID 58581959
(2S,3R)-2-methyl-6-trimethylsilyl-1-tritiooxyhex-5-yn-3-ol (PubChem CID 58581959) has the molecular formula C10H20O2Si and a molecular weight of 202.36 g/mol. Its IUPAC name is (2S,3R)-2-methyl-6-trimethylsilyl-1-tritiooxyhex-5-yn-3-ol.
| Compound Name | (2S,3R)-2-methyl-6-trimethylsilyl-1-tritiooxyhex-5-yn-3-ol |
|---|---|
| PubChem CID | 58581959 |
| Molecular Formula | C10H20O2Si |
| Molecular Weight | 202.36 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | (2S,3R)-2-methyl-6-trimethylsilyl-1-tritiooxyhex-5-yn-3-ol |
| SMILES | [3H]OC[C@H](C)[C@H](O)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C10H20O2Si/c1-9(8-11)10(12)6-5-7-13(2,3)4/h9-12H,6,8H2,1-4H3/t9-,10+/m0/s1/i11T |
| InChIKey | CUXDYTBZBMROGK-ZOHMOBRSSA-N |
| XLogP | 1.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|