C18H28N4O4 — CID 58582013
[(2S)-1-[(3-cyano-1-ethylpyrrolidin-3-yl)amino]-4-methyl-1-oxopent-4-en-2-yl] morpholine-4-carboxylate (PubChem CID 58582013) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is [(2S)-1-[(3-cyano-1-ethylpyrrolidin-3-yl)amino]-4-methyl-1-oxopent-4-en-2-yl] morpholine-4-carboxylate.
| Compound Name | [(2S)-1-[(3-cyano-1-ethylpyrrolidin-3-yl)amino]-4-methyl-1-oxopent-4-en-2-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 58582013 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | [(2S)-1-[(3-cyano-1-ethylpyrrolidin-3-yl)amino]-4-methyl-1-oxopent-4-en-2-yl] morpholine-4-carboxylate |
| SMILES | C=C(C)C[C@H](OC(=O)N1CCOCC1)C(=O)NC1(C#N)CCN(CC)C1 |
| InChI | InChI=1S/C18H28N4O4/c1-4-21-6-5-18(12-19,13-21)20-16(23)15(11-14(2)3)26-17(24)22-7-9-25-10-8-22/h15H,2,4-11,13H2,1,3H3,(H,20,23)/t15-,18?/m0/s1 |
| InChIKey | KUWCDGWEDMQCBN-BUSXIPJBSA-N |
| XLogP | 0.89 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|