C23H20FN3O2 — CID 58582177
7-fluoro-3-naphthalen-2-yl-N-[[(2R)-oxolan-2-yl]methyl]-2H-indazole-5-carboxamide (PubChem CID 58582177) has the molecular formula C23H20FN3O2 and a molecular weight of 389.43 g/mol. Its IUPAC name is 7-fluoro-3-naphthalen-2-yl-N-[[(2R)-oxolan-2-yl]methyl]-2H-indazole-5-carboxamide.
| Compound Name | 7-fluoro-3-naphthalen-2-yl-N-[[(2R)-oxolan-2-yl]methyl]-2H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 58582177 |
| Molecular Formula | C23H20FN3O2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 7-fluoro-3-naphthalen-2-yl-N-[[(2R)-oxolan-2-yl]methyl]-2H-indazole-5-carboxamide |
| SMILES | O=C(NC[C@H]1CCCO1)c1cc(F)c2n[nH]c(-c3ccc4ccccc4c3)c2c1 |
| InChI | InChI=1S/C23H20FN3O2/c24-20-12-17(23(28)25-13-18-6-3-9-29-18)11-19-21(26-27-22(19)20)16-8-7-14-4-1-2-5-15(14)10-16/h1-2,4-5,7-8,10-12,18H,3,6,9,13H2,(H,25,28)(H,26,27)/t18-/m1/s1 |
| InChIKey | GFQWFUKQHBAXMB-GOSISDBHSA-N |
| XLogP | 4.43 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |