C39H78O6Si3 — CID 58582980
(4R,7R,8R,9R,13Z,16S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-16-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 58582980) has the molecular formula C39H78O6Si3 and a molecular weight of 727.31 g/mol. Its IUPAC name is (4R,7R,8R,9R,13Z,16S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-16-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4R,7R,8R,9R,13Z,16S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-16-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 58582980 |
| Molecular Formula | C39H78O6Si3 |
| Molecular Weight | 727.31 g/mol |
| Exact Mass | 726.51 |
| IUPAC Name | (4R,7R,8R,9R,13Z,16S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-16-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-5,5,7,9-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)[C@@H]1C/C=C\CCC[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C39H78O6Si3/c1-28-25-23-21-22-24-26-31(30(3)43-46(15,16)36(4,5)6)42-33(40)27-32(44-47(17,18)37(7,8)9)39(13,14)35(41)29(2)34(28)45-48(19,20)38(10,11)12/h22,24,28-32,34H,21,23,25-27H2,1-20H3/b24-22-/t28-,29-,30?,31+,32-,34-/m1/s1 |
| InChIKey | BVXVPKDMYOWYEJ-BQFWPKKQSA-N |
| XLogP | 11.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.31 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|