C24H33N5O — CID 58584033
3-[4-(diethylamino)-2-methylphenyl]imino-2-methyl-5-propan-2-yl-6-propylpyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 58584033) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is 3-[4-(diethylamino)-2-methylphenyl]imino-2-methyl-5-propan-2-yl-6-propylpyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 3-[4-(diethylamino)-2-methylphenyl]imino-2-methyl-5-propan-2-yl-6-propylpyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 58584033 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | 3-[4-(diethylamino)-2-methylphenyl]imino-2-methyl-5-propan-2-yl-6-propylpyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCCc1c(C(C)C)nc2n(c1=O)N=C(C)/C2=N\c1ccc(N(CC)CC)cc1C |
| InChI | InChI=1S/C24H33N5O/c1-8-11-19-21(15(4)5)26-23-22(17(7)27-29(23)24(19)30)25-20-13-12-18(14-16(20)6)28(9-2)10-3/h12-15H,8-11H2,1-7H3/b25-22+ |
| InChIKey | KUAYNHCEBZQSAB-YYDJUVGSSA-N |
| XLogP | 4.83 |
| TPSA | 62.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|