C25H32N8O — CID 58621636
7-[4-(diethylamino)-2-methylphenyl]imino-3-(1,5-dimethylpyrazol-3-yl)-N,N,2-trimethylimidazo[1,2-b]pyrazole-6-carboxamide (PubChem CID 58621636) has the molecular formula C25H32N8O and a molecular weight of 460.59 g/mol. Its IUPAC name is 7-[4-(diethylamino)-2-methylphenyl]imino-3-(1,5-dimethylpyrazol-3-yl)-N,N,2-trimethylimidazo[1,2-b]pyrazole-6-carboxamide.
| Compound Name | 7-[4-(diethylamino)-2-methylphenyl]imino-3-(1,5-dimethylpyrazol-3-yl)-N,N,2-trimethylimidazo[1,2-b]pyrazole-6-carboxamide |
|---|---|
| PubChem CID | 58621636 |
| Molecular Formula | C25H32N8O |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 7-[4-(diethylamino)-2-methylphenyl]imino-3-(1,5-dimethylpyrazol-3-yl)-N,N,2-trimethylimidazo[1,2-b]pyrazole-6-carboxamide |
| SMILES | CCN(CC)c1ccc(/N=C2/C(C(=O)N(C)C)=Nn3c2nc(C)c3-c2cc(C)n(C)n2)c(C)c1 |
| InChI | InChI=1S/C25H32N8O/c1-9-32(10-2)18-11-12-19(15(3)13-18)27-21-22(25(34)30(6)7)29-33-23(17(5)26-24(21)33)20-14-16(4)31(8)28-20/h11-14H,9-10H2,1-8H3/b27-21- |
| InChIKey | OUQWIHLZIFEMEC-MEFGMAGPSA-N |
| XLogP | 3.48 |
| TPSA | 83.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|