C23H28N8O — CID 71190923
[7-[4-(diethylamino)-2-methylphenyl]imino-3-pyridin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-yl]-(dimethylamino)methanol (PubChem CID 71190923) has the molecular formula C23H28N8O and a molecular weight of 432.53 g/mol. Its IUPAC name is [7-[4-(diethylamino)-2-methylphenyl]imino-3-pyridin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-yl]-(dimethylamino)methanol.
| Compound Name | [7-[4-(diethylamino)-2-methylphenyl]imino-3-pyridin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-yl]-(dimethylamino)methanol |
|---|---|
| PubChem CID | 71190923 |
| Molecular Formula | C23H28N8O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | [7-[4-(diethylamino)-2-methylphenyl]imino-3-pyridin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-yl]-(dimethylamino)methanol |
| SMILES | CCN(CC)c1ccc(/N=C2/C(C(O)N(C)C)=Nn3c2nnc3-c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C23H28N8O/c1-6-30(7-2)16-11-12-17(15(3)14-16)25-19-20(23(32)29(4)5)28-31-21(26-27-22(19)31)18-10-8-9-13-24-18/h8-14,23,32H,6-7H2,1-5H3/b25-19- |
| InChIKey | QXXMWEOHEZFCNA-PLRJNAJWSA-N |
| XLogP | 2.71 |
| TPSA | 95.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|