C36H41N5O4 — CID 20717682
3-[4-(diethylamino)-2-methylphenyl]imino-2-[2-[2-(2-ethoxyethoxy)ethoxy]phenyl]-6-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 20717682) has the molecular formula C36H41N5O4 and a molecular weight of 607.75 g/mol. Its IUPAC name is 3-[4-(diethylamino)-2-methylphenyl]imino-2-[2-[2-(2-ethoxyethoxy)ethoxy]phenyl]-6-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 3-[4-(diethylamino)-2-methylphenyl]imino-2-[2-[2-(2-ethoxyethoxy)ethoxy]phenyl]-6-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 20717682 |
| Molecular Formula | C36H41N5O4 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | 3-[4-(diethylamino)-2-methylphenyl]imino-2-[2-[2-(2-ethoxyethoxy)ethoxy]phenyl]-6-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCOCCOCCOc1ccccc1C1=Nn2c(nc(-c3ccccc3)c(C)c2=O)/C1=N\c1ccc(N(CC)CC)cc1C |
| InChI | InChI=1S/C36H41N5O4/c1-6-40(7-2)28-18-19-30(25(4)24-28)37-34-33(29-16-12-13-17-31(29)45-23-22-44-21-20-43-8-3)39-41-35(34)38-32(26(5)36(41)42)27-14-10-9-11-15-27/h9-19,24H,6-8,20-23H2,1-5H3/b37-34- |
| InChIKey | ZUMOUPLCQAVOFX-LLLYXHGFSA-N |
| XLogP | 6.19 |
| TPSA | 90.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|