C31H30ClN5O2 — CID 20717696
2-(2-chlorophenyl)-3-[4-[ethyl(2-methoxyethyl)amino]-2-methylphenyl]imino-5-methyl-6-phenylpyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 20717696) has the molecular formula C31H30ClN5O2 and a molecular weight of 540.07 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-[4-[ethyl(2-methoxyethyl)amino]-2-methylphenyl]imino-5-methyl-6-phenylpyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-(2-chlorophenyl)-3-[4-[ethyl(2-methoxyethyl)amino]-2-methylphenyl]imino-5-methyl-6-phenylpyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 20717696 |
| Molecular Formula | C31H30ClN5O2 |
| Molecular Weight | 540.07 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 2-(2-chlorophenyl)-3-[4-[ethyl(2-methoxyethyl)amino]-2-methylphenyl]imino-5-methyl-6-phenylpyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCN(CCOC)c1ccc(/N=C2/C(c3ccccc3Cl)=Nn3c2nc(C)c(-c2ccccc2)c3=O)c(C)c1 |
| InChI | InChI=1S/C31H30ClN5O2/c1-5-36(17-18-39-4)23-15-16-26(20(2)19-23)34-29-28(24-13-9-10-14-25(24)32)35-37-30(29)33-21(3)27(31(37)38)22-11-7-6-8-12-22/h6-16,19H,5,17-18H2,1-4H3/b34-29- |
| InChIKey | JPENPCBWSHLGDZ-BNIPGBBVSA-N |
| XLogP | 6.04 |
| TPSA | 72.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.07 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|