C37H43N5O3S — CID 20717654
6-butyl-5-(3-ethoxyphenyl)-3-[4-[ethyl(2-methoxyethyl)amino]-2-methylphenyl]imino-2-(2-methylsulfanylphenyl)pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 20717654) has the molecular formula C37H43N5O3S and a molecular weight of 637.85 g/mol. Its IUPAC name is 6-butyl-5-(3-ethoxyphenyl)-3-[4-[ethyl(2-methoxyethyl)amino]-2-methylphenyl]imino-2-(2-methylsulfanylphenyl)pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 6-butyl-5-(3-ethoxyphenyl)-3-[4-[ethyl(2-methoxyethyl)amino]-2-methylphenyl]imino-2-(2-methylsulfanylphenyl)pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 20717654 |
| Molecular Formula | C37H43N5O3S |
| Molecular Weight | 637.85 g/mol |
| Exact Mass | 637.31 |
| IUPAC Name | 6-butyl-5-(3-ethoxyphenyl)-3-[4-[ethyl(2-methoxyethyl)amino]-2-methylphenyl]imino-2-(2-methylsulfanylphenyl)pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCCCc1c(-c2cccc(OCC)c2)nc2n(c1=O)N=C(c1ccccc1SC)/C2=N/c1ccc(N(CC)CCOC)cc1C |
| InChI | InChI=1S/C37H43N5O3S/c1-7-10-16-30-33(26-14-13-15-28(24-26)45-9-3)39-36-35(34(40-42(36)37(30)43)29-17-11-12-18-32(29)46-6)38-31-20-19-27(23-25(31)4)41(8-2)21-22-44-5/h11-15,17-20,23-24H,7-10,16,21-22H2,1-6H3/b38-35- |
| InChIKey | DDSVXZYICCRRHY-DIGXQUICSA-N |
| XLogP | 7.54 |
| TPSA | 81.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.85 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|