C72H48FeN8O8Ra — CID 58584371
CID 58584371 (PubChem CID 58584371) has the molecular formula C72H48FeN8O8Ra and a molecular weight of 1435.07 g/mol.
| Compound Name | CID 58584371 |
|---|---|
| PubChem CID | 58584371 |
| Molecular Formula | C72H48FeN8O8Ra |
| Molecular Weight | 1435.07 g/mol |
| Exact Mass | 1434.32 |
| IUPAC Name | — |
| SMILES | O=C([O-])c1ccccc1C[n+]1ccccc1-c1c2nc(c(-c3cccc[n+]3Cc3ccccc3C(=O)[O-])c3ccc([n-]3)c(-c3cccc[n+]3Cc3ccccc3C(=O)[O-])c3nc(c(-c4cccc[n+]4Cc4ccccc4C(=O)[O-])c4ccc1[n-]4)C=C3)C=C2.[Fe+2].[Ra] |
| InChI | InChI=1S/C72H50N8O8.Fe.Ra/c81-69(82)49-21-5-1-17-45(49)41-77-37-13-9-25-61(77)65-53-29-31-55(73-53)66(62-26-10-14-38-78(62)42-46-18-2-6-22-50(46)70(83)84)57-33-35-59(75-57)68(64-28-12-16-40-80(64)44-48-20-4-8-24-52(48)72(87)88)60-36-34-58(76-60)67(56-32-30-54(65)74-56)63-27-11-15-39-79(63)43-47-19-3-7-23-51(47)71(85)86;;/h1-40H,41-44H2,(H2-3,73,74,75,76,81,82,83,84,85,86,87,88);;/q;+2;/p-2/b65-53+,65-54+,66-55+,66-57+,67-56+,67-58+,68-59+,68-60+;; |
| InChIKey | PFMKJKZNLZIKEH-KSUUBVDHSA-L |
| XLogP | 5.38 |
| TPSA | 230.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1435.07 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|