C15H14N4O4 — CID 58586336
N-[(E)-(4-acetylphenyl)methylideneamino]-2-(4,6-dioxo-1H-pyridazin-3-yl)acetamide (PubChem CID 58586336) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is N-[(E)-(4-acetylphenyl)methylideneamino]-2-(4,6-dioxo-1H-pyridazin-3-yl)acetamide.
| Compound Name | N-[(E)-(4-acetylphenyl)methylideneamino]-2-(4,6-dioxo-1H-pyridazin-3-yl)acetamide |
|---|---|
| PubChem CID | 58586336 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-[(E)-(4-acetylphenyl)methylideneamino]-2-(4,6-dioxo-1H-pyridazin-3-yl)acetamide |
| SMILES | CC(=O)c1ccc(/C=N/NC(=O)CC2=NNC(=O)CC2=O)cc1 |
| InChI | InChI=1S/C15H14N4O4/c1-9(20)11-4-2-10(3-5-11)8-16-18-14(22)6-12-13(21)7-15(23)19-17-12/h2-5,8H,6-7H2,1H3,(H,18,22)(H,19,23)/b16-8+ |
| InChIKey | GQIJJTQACOTFOO-LZYBPNLTSA-N |
| XLogP | 0.17 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|