About 3-(carboxymethoxy)propylazanide;rutherfordium
3-(carboxymethoxy)propylazanide;rutherfordium (PubChem CID 58587208) has the molecular formula C5H10NO3Rf-
and a molecular weight of 399.14 g/mol. Its IUPAC name is 3-(carboxymethoxy)propylazanide;rutherfordium.
Molecular Properties
| Compound Name | 3-(carboxymethoxy)propylazanide;rutherfordium |
| PubChem CID | 58587208 |
| Molecular Formula | C5H10NO3Rf- |
| Molecular Weight | 399.14 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 3-(carboxymethoxy)propylazanide;rutherfordium |
| SMILES | [NH-]CCCOCC(=O)O.[Rf] |
| InChI | InChI=1S/C5H10NO3.Rf/c6-2-1-3-9-4-5(7)8;/h6H,1-4H2,(H,7,8);/q-1; |
| InChIKey | BITHKNUDWNHABT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 70.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.14 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(carboxymethoxy)propylazanide;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(carboxymethoxy)propylazanide;rutherfordium?
The IUPAC name of 3-(carboxymethoxy)propylazanide;rutherfordium (CID 58587208) is 3-(carboxymethoxy)propylazanide;rutherfordium.
What is the SMILES notation for 3-(carboxymethoxy)propylazanide;rutherfordium?
The canonical SMILES for 3-(carboxymethoxy)propylazanide;rutherfordium is [NH-]CCCOCC(=O)O.[Rf].
What is the InChIKey of 3-(carboxymethoxy)propylazanide;rutherfordium?
The InChIKey is BITHKNUDWNHABT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO3.Rf/c6-2-1-3-9-4-5(7)8;/h6H,1-4H2,(H,7,8);/q-1;.
What are the key properties of 3-(carboxymethoxy)propylazanide;rutherfordium?
3-(carboxymethoxy)propylazanide;rutherfordium has a molecular weight of 399.14 g/mol, XLogP of 0.53, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(carboxymethoxy)propylazanide;rutherfordium is sourced from PubChem (CID 58587208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).