C13H19N5O2 — CID 58589845
3-tert-butyl-1-(2,6-dimethoxypyrimidin-4-yl)pyrazol-5-amine (PubChem CID 58589845) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 3-tert-butyl-1-(2,6-dimethoxypyrimidin-4-yl)pyrazol-5-amine.
| Compound Name | 3-tert-butyl-1-(2,6-dimethoxypyrimidin-4-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 58589845 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3-tert-butyl-1-(2,6-dimethoxypyrimidin-4-yl)pyrazol-5-amine |
| SMILES | COc1cc(-n2nc(C(C)(C)C)cc2N)nc(OC)n1 |
| InChI | InChI=1S/C13H19N5O2/c1-13(2,3)8-6-9(14)18(17-8)10-7-11(19-4)16-12(15-10)20-5/h6-7H,14H2,1-5H3 |
| InChIKey | DIVLBVGWRWDNTO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |