C34H60 — CID 58590874
(2S,3S,5R,6S,10S,13R,17R)-2,3,6,10,13-pentamethyl-17-[(E,2R)-5,6,6,7-tetramethyloct-4-en-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 58590874) has the molecular formula C34H60 and a molecular weight of 468.85 g/mol. Its IUPAC name is (2S,3S,5R,6S,10S,13R,17R)-2,3,6,10,13-pentamethyl-17-[(E,2R)-5,6,6,7-tetramethyloct-4-en-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (2S,3S,5R,6S,10S,13R,17R)-2,3,6,10,13-pentamethyl-17-[(E,2R)-5,6,6,7-tetramethyloct-4-en-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 58590874 |
| Molecular Formula | C34H60 |
| Molecular Weight | 468.85 g/mol |
| Exact Mass | 468.47 |
| IUPAC Name | (2S,3S,5R,6S,10S,13R,17R)-2,3,6,10,13-pentamethyl-17-[(E,2R)-5,6,6,7-tetramethyloct-4-en-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C/C(=C\C[C@@H](C)[C@H]1CCC2C3C[C@H](C)[C@H]4C[C@H](C)[C@@H](C)C[C@]4(C)C3CC[C@@]21C)C(C)(C)C(C)C |
| InChI | InChI=1S/C34H60/c1-21(2)32(8,9)26(7)13-12-22(3)28-14-15-29-27-18-24(5)31-19-23(4)25(6)20-34(31,11)30(27)16-17-33(28,29)10/h13,21-25,27-31H,12,14-20H2,1-11H3/b26-13+/t22-,23+,24+,25+,27?,28-,29?,30?,31-,33-,34-/m1/s1 |
| InChIKey | VCOBDVCAPMMMJE-NSLBWEHJSA-N |
| XLogP | 10.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.85 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|