C13H22N2O3 — CID 58592754
tert-butyl 2-ethyl-4-(1-hydroxyethyl)-5-methylimidazole-1-carboxylate (PubChem CID 58592754) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl 2-ethyl-4-(1-hydroxyethyl)-5-methylimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-ethyl-4-(1-hydroxyethyl)-5-methylimidazole-1-carboxylate |
|---|---|
| PubChem CID | 58592754 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | tert-butyl 2-ethyl-4-(1-hydroxyethyl)-5-methylimidazole-1-carboxylate |
| SMILES | CCc1nc(C(C)O)c(C)n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22N2O3/c1-7-10-14-11(9(3)16)8(2)15(10)12(17)18-13(4,5)6/h9,16H,7H2,1-6H3 |
| InChIKey | CYCYAQPHCRCAMF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |