C12H15NO2SSe2 — CID 54754240
tert-butyl 4,6-dimethyl-2-sulfanylidene-[1,3]diselenolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 54754240) has the molecular formula C12H15NO2SSe2 and a molecular weight of 395.24 g/mol. Its IUPAC name is tert-butyl 4,6-dimethyl-2-sulfanylidene-[1,3]diselenolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 4,6-dimethyl-2-sulfanylidene-[1,3]diselenolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 54754240 |
| Molecular Formula | C12H15NO2SSe2 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 396.92 |
| IUPAC Name | tert-butyl 4,6-dimethyl-2-sulfanylidene-[1,3]diselenolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | Cc1c2[se]c(=S)[se]c2c(C)n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H15NO2SSe2/c1-6-8-9(18-11(16)17-8)7(2)13(6)10(14)15-12(3,4)5/h1-5H3 |
| InChIKey | QMLFCOYTHZZODF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|