C23H23NO4 — CID 58593155
(3R,3aR,6aS)-3-[(1S)-1-hydroxyethyl]-1-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one (PubChem CID 58593155) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is (3R,3aR,6aS)-3-[(1S)-1-hydroxyethyl]-1-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one.
| Compound Name | (3R,3aR,6aS)-3-[(1S)-1-hydroxyethyl]-1-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
|---|---|
| PubChem CID | 58593155 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (3R,3aR,6aS)-3-[(1S)-1-hydroxyethyl]-1-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
| SMILES | Cc1ccc(C#Cc2ccc(CN3O[C@@H]([C@H](C)O)[C@H]4COC(=O)[C@H]43)cc2)cc1 |
| InChI | InChI=1S/C23H23NO4/c1-15-3-5-17(6-4-15)7-8-18-9-11-19(12-10-18)13-24-21-20(14-27-23(21)26)22(28-24)16(2)25/h3-6,9-12,16,20-22,25H,13-14H2,1-2H3/t16-,20-,21-,22-/m0/s1 |
| InChIKey | FBFXZCWSBPKNEE-KPQYALRZSA-N |
| XLogP | 2.43 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|