C17H36O4Si — CID 58593349
[(2S)-3-ethoxy-2-methyl-2-triethylsilyloxypropyl] 2,2-dimethylpropanoate (PubChem CID 58593349) has the molecular formula C17H36O4Si and a molecular weight of 332.56 g/mol. Its IUPAC name is [(2S)-3-ethoxy-2-methyl-2-triethylsilyloxypropyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-3-ethoxy-2-methyl-2-triethylsilyloxypropyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58593349 |
| Molecular Formula | C17H36O4Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [(2S)-3-ethoxy-2-methyl-2-triethylsilyloxypropyl] 2,2-dimethylpropanoate |
| SMILES | CCOC[C@@](C)(COC(=O)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C17H36O4Si/c1-9-19-13-17(8,14-20-15(18)16(5,6)7)21-22(10-2,11-3)12-4/h9-14H2,1-8H3/t17-/m0/s1 |
| InChIKey | FXIWPJKODGLSOZ-KRWDZBQOSA-N |
| XLogP | 4.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|