C10H18N2O2 — CID 58593540
(2S)-2-[(E,2S)-2-(methylamino)pent-3-enyl]morpholin-3-one (PubChem CID 58593540) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is (2S)-2-[(E,2S)-2-(methylamino)pent-3-enyl]morpholin-3-one.
| Compound Name | (2S)-2-[(E,2S)-2-(methylamino)pent-3-enyl]morpholin-3-one |
|---|---|
| PubChem CID | 58593540 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (2S)-2-[(E,2S)-2-(methylamino)pent-3-enyl]morpholin-3-one |
| SMILES | C/C=C/[C@H](C[C@@H]1OCCNC1=O)NC |
| InChI | InChI=1S/C10H18N2O2/c1-3-4-8(11-2)7-9-10(13)12-5-6-14-9/h3-4,8-9,11H,5-7H2,1-2H3,(H,12,13)/b4-3+/t8-,9+/m1/s1 |
| InChIKey | PDXMUDFGRQVAAB-BKIAHZASSA-N |
| XLogP | 0.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|