C11H18N2O3 — CID 59079558
(2S)-2-[(E,2S)-2-(methylamino)-5-oxohex-3-enyl]morpholin-3-one (PubChem CID 59079558) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is (2S)-2-[(E,2S)-2-(methylamino)-5-oxohex-3-enyl]morpholin-3-one.
| Compound Name | (2S)-2-[(E,2S)-2-(methylamino)-5-oxohex-3-enyl]morpholin-3-one |
|---|---|
| PubChem CID | 59079558 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (2S)-2-[(E,2S)-2-(methylamino)-5-oxohex-3-enyl]morpholin-3-one |
| SMILES | CN[C@H](/C=C/C(C)=O)C[C@@H]1OCCNC1=O |
| InChI | InChI=1S/C11H18N2O3/c1-8(14)3-4-9(12-2)7-10-11(15)13-5-6-16-10/h3-4,9-10,12H,5-7H2,1-2H3,(H,13,15)/b4-3+/t9-,10+/m1/s1 |
| InChIKey | JNMCKEREBJLZBP-OKWQPMOJSA-N |
| XLogP | -0.38 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|