C37H36F3NO — CID 58596660
1,1,3-triethyl-9'-phenyl-6'-(trifluoromethyl)spiro[6,7,8,9-tetrahydrobenzo[e]indole-2,3'-benzo[f]chromene] (PubChem CID 58596660) has the molecular formula C37H36F3NO and a molecular weight of 567.70 g/mol. Its IUPAC name is 1,1,3-triethyl-9'-phenyl-6'-(trifluoromethyl)spiro[6,7,8,9-tetrahydrobenzo[e]indole-2,3'-benzo[f]chromene].
| Compound Name | 1,1,3-triethyl-9'-phenyl-6'-(trifluoromethyl)spiro[6,7,8,9-tetrahydrobenzo[e]indole-2,3'-benzo[f]chromene] |
|---|---|
| PubChem CID | 58596660 |
| Molecular Formula | C37H36F3NO |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 1,1,3-triethyl-9'-phenyl-6'-(trifluoromethyl)spiro[6,7,8,9-tetrahydrobenzo[e]indole-2,3'-benzo[f]chromene] |
| SMILES | CCN1c2ccc3c(c2C(CC)(CC)C12C=Cc1c(cc(C(F)(F)F)c4ccc(-c5ccccc5)cc14)O2)CCCC3 |
| InChI | InChI=1S/C37H36F3NO/c1-4-35(5-2)34-27-15-11-10-14-25(27)17-19-32(34)41(6-3)36(35)21-20-29-30-22-26(24-12-8-7-9-13-24)16-18-28(30)31(37(38,39)40)23-33(29)42-36/h7-9,12-13,16-23H,4-6,10-11,14-15H2,1-3H3 |
| InChIKey | KTYFHDMFWJFATM-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |