About 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide
3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide (PubChem CID 2729897) has the molecular formula C25H24N2O2
and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide.
Molecular Properties
| Compound Name | 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide |
| PubChem CID | 2729897 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide |
| SMILES | CC1(C)c2ccccc2N(CCC(N)=O)C12C=Cc1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C25H24N2O2/c1-24(2)20-9-5-6-10-21(20)27(16-14-23(26)28)25(24)15-13-19-18-8-4-3-7-17(18)11-12-22(19)29-25/h3-13,15H,14,16H2,1-2H3,(H2,26,28) |
| InChIKey | ZIWLSXUIITVCGZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide?
The IUPAC name of 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide (CID 2729897) is 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide.
What is the SMILES notation for 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide?
The canonical SMILES for 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide is CC1(C)c2ccccc2N(CCC(N)=O)C12C=Cc1c(ccc3ccccc13)O2.
What is the InChIKey of 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide?
The InChIKey is ZIWLSXUIITVCGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O2/c1-24(2)20-9-5-6-10-21(20)27(16-14-23(26)28)25(24)15-13-19-18-8-4-3-7-17(18)11-12-22(19)29-25/h3-13,15H,14,16H2,1-2H3,(H2,26,28).
What are the key properties of 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide?
3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide has a molecular weight of 384.48 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)propanamide is sourced from PubChem (CID 2729897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).