C19H26O6 — CID 58596952
(2S,3R,4R,5S,6R)-2-[3-[(4-hydroxycyclohexylidene)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 58596952) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[(4-hydroxycyclohexylidene)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[(4-hydroxycyclohexylidene)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58596952 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[(4-hydroxycyclohexylidene)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cccc(C=C3CCC(O)CC3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H26O6/c20-10-15-16(22)17(23)18(24)19(25-15)13-3-1-2-12(9-13)8-11-4-6-14(21)7-5-11/h1-3,8-9,14-24H,4-7,10H2/b11-8-/t14?,15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | AXDXBNWVMRCRDT-QHBPDUPBSA-N |
| XLogP | 0.52 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |