C22H29ClN2O5 — CID 58596968
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-pyrazol-1-ylcyclohexyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 58596968) has the molecular formula C22H29ClN2O5 and a molecular weight of 436.94 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-pyrazol-1-ylcyclohexyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-pyrazol-1-ylcyclohexyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58596968 |
| Molecular Formula | C22H29ClN2O5 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-pyrazol-1-ylcyclohexyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(CC3CCC(n4cccn4)CC3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H29ClN2O5/c23-17-7-4-14(22-21(29)20(28)19(27)18(12-26)30-22)11-15(17)10-13-2-5-16(6-3-13)25-9-1-8-24-25/h1,4,7-9,11,13,16,18-22,26-29H,2-3,5-6,10,12H2/t13?,16?,18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | BAXVNIZUQBKGQU-GRRMPDNTSA-N |
| XLogP | 2.03 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |