About 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene
2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene (PubChem CID 58598898) has the molecular formula C20H13F7O2
and a molecular weight of 418.31 g/mol. Its IUPAC name is 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene.
Molecular Properties
| Compound Name | 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene |
| PubChem CID | 58598898 |
| Molecular Formula | C20H13F7O2 |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene |
| SMILES | CCc1ccc2cc(C(F)(F)Oc3cc(F)c(OC(F)(F)F)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C20H13F7O2/c1-2-11-3-4-13-8-14(6-5-12(13)7-11)19(23,24)28-15-9-16(21)18(17(22)10-15)29-20(25,26)27/h3-10H,2H2,1H3 |
| InChIKey | SYKSKZJCRDZFMW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene?
The IUPAC name of 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene (CID 58598898) is 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene.
What is the SMILES notation for 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene?
The canonical SMILES for 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene is CCc1ccc2cc(C(F)(F)Oc3cc(F)c(OC(F)(F)F)c(F)c3)ccc2c1.
What is the InChIKey of 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene?
The InChIKey is SYKSKZJCRDZFMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F7O2/c1-2-11-3-4-13-8-14(6-5-12(13)7-11)19(23,24)28-15-9-16(21)18(17(22)10-15)29-20(25,26)27/h3-10H,2H2,1H3.
What are the key properties of 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene?
2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene has a molecular weight of 418.31 g/mol, XLogP of 6.71, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-6-ethylnaphthalene is sourced from PubChem (CID 58598898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).