C5H8O3 — CID 58602405
(3S,4S)-2-methylideneoxolane-3,4-diol (PubChem CID 58602405) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is (3S,4S)-2-methylideneoxolane-3,4-diol.
| Compound Name | (3S,4S)-2-methylideneoxolane-3,4-diol |
|---|---|
| PubChem CID | 58602405 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | (3S,4S)-2-methylideneoxolane-3,4-diol |
| SMILES | C=C1OC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H8O3/c1-3-5(7)4(6)2-8-3/h4-7H,1-2H2/t4-,5+/m0/s1 |
| InChIKey | SIRMHEXXKZVLKM-CRCLSJGQSA-N |
| XLogP | -0.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |