C18H15N5O3 — CID 58602962
3-[5-[(E)-[methyl-(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)hydrazinylidene]methyl]furan-2-yl]benzonitrile (PubChem CID 58602962) has the molecular formula C18H15N5O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is 3-[5-[(E)-[methyl-(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)hydrazinylidene]methyl]furan-2-yl]benzonitrile.
| Compound Name | 3-[5-[(E)-[methyl-(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)hydrazinylidene]methyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 58602962 |
| Molecular Formula | C18H15N5O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 3-[5-[(E)-[methyl-(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)hydrazinylidene]methyl]furan-2-yl]benzonitrile |
| SMILES | CN(/N=C/c1ccc(-c2cccc(C#N)c2)o1)c1cc(=O)n(C)c(=O)[nH]1 |
| InChI | InChI=1S/C18H15N5O3/c1-22-17(24)9-16(21-18(22)25)23(2)20-11-14-6-7-15(26-14)13-5-3-4-12(8-13)10-19/h3-9,11H,1-2H3,(H,21,25)/b20-11+ |
| InChIKey | JOSHELCQVNAUJO-RGVLZGJSSA-N |
| XLogP | 1.68 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|